Names and Identifiers
| Name | o-Acetoacetaniside |
| Synonyms | AAOA ortho-acetoacetanisidide Acetoacetanisidide o-acetoacetanisidide acetoacetyl-o-anisidine Acetoacetic-o-anisidide AcetoAcet-O-Anisilide Acetoacet-O-Anisidine 2-methoxyacetoacetanilide Acetoacetyl-o-acetanisidine N-(2-Methoxyphenyl)-3-oxobutanamide |
| CAS | 92-15-9 |
| EINECS | 202-131-0 |
| InChI | InChI=1/C11H13NO3/c1-8(13)7-11(14)12-9-5-3-4-6-10(9)15-2/h3-6H,7H2,1-2H3,(H,12,14) |
Physico-chemical Properties
| Molecular Formula | C11H13NO3 |
| Molar Mass | 207.226 g/mol |
| Density | 1.173g/cm3 |
| Melting Point | 84-87℃ |
| Boling Point | 372.9°C at 760 mmHg |
| Flash Point | 179.3°C |
| Vapor Presure | 9.32E-06mmHg at 25°C |
| Refractive Index | 1.552 |
Other information
| Application | Used as intermediates for dyestuff and organic pigments as well as for synthesizing yellow and light-resistant dyes and direct light yellow 5G. |
| Specification | Purity: ≥99% Appearance: White crystalline powder |
chemical.tnj
+8618949823763
tnjchem
2881500864